C16H17ClN2O2 — CID 61290273
1-[(7-chloroquinolin-4-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 61290273) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 1-[(7-chloroquinolin-4-yl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(7-chloroquinolin-4-yl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 61290273 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[(7-chloroquinolin-4-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(Nc2ccnc3cc(Cl)ccc23)CCCCC1 |
| InChI | InChI=1S/C16H17ClN2O2/c17-11-4-5-12-13(6-9-18-14(12)10-11)19-16(15(20)21)7-2-1-3-8-16/h4-6,9-10H,1-3,7-8H2,(H,18,19)(H,20,21) |
| InChIKey | UOTSELIGYFSVLO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |