C15H19N3O2S — CID 61298652
4-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzenecarboximidamide (PubChem CID 61298652) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzenecarboximidamide.
| Compound Name | 4-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 61298652 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCOCCc2scnc2C)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-11-14(21-10-18-11)6-7-19-8-9-20-13-4-2-12(3-5-13)15(16)17/h2-5,10H,6-9H2,1H3,(H3,16,17) |
| InChIKey | PSJVLTZHAIMDIC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|