C14H18N4 — CID 61336592
[3-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine (PubChem CID 61336592) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is [3-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine.
| Compound Name | [3-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 61336592 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [3-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)phenyl]methanamine |
| SMILES | NCc1cccc(-c2n[nH]c(C3CCCC3)n2)c1 |
| InChI | InChI=1S/C14H18N4/c15-9-10-4-3-7-12(8-10)14-16-13(17-18-14)11-5-1-2-6-11/h3-4,7-8,11H,1-2,5-6,9,15H2,(H,16,17,18) |
| InChIKey | VEBLAFCKEYHSEO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |