C12H19N3O2S — CID 61350746
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(pyridin-3-ylmethyl)propan-1-amine (PubChem CID 61350746) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(pyridin-3-ylmethyl)propan-1-amine.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 61350746 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(pyridin-3-ylmethyl)propan-1-amine |
| SMILES | O=S1(=O)CCCN1CCCNCc1cccnc1 |
| InChI | InChI=1S/C12H19N3O2S/c16-18(17)9-3-8-15(18)7-2-6-14-11-12-4-1-5-13-10-12/h1,4-5,10,14H,2-3,6-9,11H2 |
| InChIKey | KDSOUDQNYFVFKU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|