C14H17N3O2S2 — CID 61358066
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one (PubChem CID 61358066) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 61358066 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one |
| SMILES | CC(Sc1nc2ccc(N)cc2s1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-9(13(18)17-4-6-19-7-5-17)20-14-16-11-3-2-10(15)8-12(11)21-14/h2-3,8-9H,4-7,15H2,1H3 |
| InChIKey | WYKYGAVGFHSMFJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|