C21H24Cl2N4OS2 — CID 69237126
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]propanamide (PubChem CID 69237126) has the molecular formula C21H24Cl2N4OS2 and a molecular weight of 483.49 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]propanamide.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]propanamide |
|---|---|
| PubChem CID | 69237126 |
| Molecular Formula | C21H24Cl2N4OS2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[3-[(3,4-dichlorophenyl)methyl-methylamino]propyl]propanamide |
| SMILES | CC(Sc1nc2ccc(N)cc2s1)C(=O)NCCCN(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N4OS2/c1-13(29-21-26-18-7-5-15(24)11-19(18)30-21)20(28)25-8-3-9-27(2)12-14-4-6-16(22)17(23)10-14/h4-7,10-11,13H,3,8-9,12,24H2,1-2H3,(H,25,28) |
| InChIKey | MPPJHCWJEWTILU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|