C11H15N3O2S — CID 61362713
N-amino-N'-cyclopropyl-3-methylsulfonylbenzenecarboximidamide (PubChem CID 61362713) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is N-amino-N'-cyclopropyl-3-methylsulfonylbenzenecarboximidamide.
| Compound Name | N-amino-N'-cyclopropyl-3-methylsulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 61362713 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N-amino-N'-cyclopropyl-3-methylsulfonylbenzenecarboximidamide |
| SMILES | CS(=O)(=O)c1cccc(/C(=N/C2CC2)NN)c1 |
| InChI | InChI=1S/C11H15N3O2S/c1-17(15,16)10-4-2-3-8(7-10)11(14-12)13-9-5-6-9/h2-4,7,9H,5-6,12H2,1H3,(H,13,14) |
| InChIKey | GMWNDHXEXLJUKN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|