C15H18N2O3 — CID 61365066
(2S)-1-(2-pyrrolidin-2-ylacetyl)-2,3-dihydroindole-2-carboxylic acid (PubChem CID 61365066) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2S)-1-(2-pyrrolidin-2-ylacetyl)-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-(2-pyrrolidin-2-ylacetyl)-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 61365066 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2S)-1-(2-pyrrolidin-2-ylacetyl)-2,3-dihydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2ccccc2N1C(=O)CC1CCCN1 |
| InChI | InChI=1S/C15H18N2O3/c18-14(9-11-5-3-7-16-11)17-12-6-2-1-4-10(12)8-13(17)15(19)20/h1-2,4,6,11,13,16H,3,5,7-9H2,(H,19,20)/t11?,13-/m0/s1 |
| InChIKey | GLHNCENIXMAYOI-YUZLPWPTSA-N |
| XLogP | 1.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |