C18H20N4O4 — CID 6138888
2-(4-nitrophenyl)-N-[(Z)-(5-piperidin-1-ylfuran-2-yl)methylideneamino]acetamide (PubChem CID 6138888) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-[(Z)-(5-piperidin-1-ylfuran-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-nitrophenyl)-N-[(Z)-(5-piperidin-1-ylfuran-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6138888 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-(4-nitrophenyl)-N-[(Z)-(5-piperidin-1-ylfuran-2-yl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N/N=C\c1ccc(N2CCCCC2)o1 |
| InChI | InChI=1S/C18H20N4O4/c23-17(12-14-4-6-15(7-5-14)22(24)25)20-19-13-16-8-9-18(26-16)21-10-2-1-3-11-21/h4-9,13H,1-3,10-12H2,(H,20,23)/b19-13- |
| InChIKey | QVWMFPDNJWSDFB-UYRXBGFRSA-N |
| XLogP | 2.87 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_A(15)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|