About 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine
2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine (PubChem CID 61418836) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine |
| PubChem CID | 61418836 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine |
| SMILES | COCCN(CCOC)CC(C)(N)C1CC1 |
| InChI | InChI=1S/C12H26N2O2/c1-12(13,11-4-5-11)10-14(6-8-15-2)7-9-16-3/h11H,4-10,13H2,1-3H3 |
| InChIKey | MCWXATYTENGYNM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine?
The IUPAC name of 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine (CID 61418836) is 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine.
What is the SMILES notation for 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine?
The canonical SMILES for 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine is COCCN(CCOC)CC(C)(N)C1CC1.
What is the InChIKey of 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine?
The InChIKey is MCWXATYTENGYNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2/c1-12(13,11-4-5-11)10-14(6-8-15-2)7-9-16-3/h11H,4-10,13H2,1-3H3.
What are the key properties of 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine?
2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine has a molecular weight of 230.35 g/mol, XLogP of 0.71, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1-N,1-N-bis(2-methoxyethyl)propane-1,2-diamine is sourced from PubChem (CID 61418836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).