C14H29NO2 — CID 78870866
3-cyclopentyl-N,N-bis(2-methoxyethyl)propan-1-amine (PubChem CID 78870866) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is 3-cyclopentyl-N,N-bis(2-methoxyethyl)propan-1-amine.
| Compound Name | 3-cyclopentyl-N,N-bis(2-methoxyethyl)propan-1-amine |
|---|---|
| PubChem CID | 78870866 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 3-cyclopentyl-N,N-bis(2-methoxyethyl)propan-1-amine |
| SMILES | COCCN(CCCC1CCCC1)CCOC |
| InChI | InChI=1S/C14H29NO2/c1-16-12-10-15(11-13-17-2)9-5-8-14-6-3-4-7-14/h14H,3-13H2,1-2H3 |
| InChIKey | YUGJVNRKWAASHH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |