C14H25N3O2S — CID 61456274
2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1-methyl-3-propan-2-ylbenzene (PubChem CID 61456274) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1-methyl-3-propan-2-ylbenzene.
| Compound Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1-methyl-3-propan-2-ylbenzene |
|---|---|
| PubChem CID | 61456274 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-[[3-aminopropyl(methyl)sulfamoyl]amino]-1-methyl-3-propan-2-ylbenzene |
| SMILES | Cc1cccc(C(C)C)c1NS(=O)(=O)N(C)CCCN |
| InChI | InChI=1S/C14H25N3O2S/c1-11(2)13-8-5-7-12(3)14(13)16-20(18,19)17(4)10-6-9-15/h5,7-8,11,16H,6,9-10,15H2,1-4H3 |
| InChIKey | XTVZXMFCHNIOKP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |