C12H20N4O3S — CID 61456490
N-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]phenyl]acetamide (PubChem CID 61456490) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 61456490 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NS(=O)(=O)N(C)CCCN)c1 |
| InChI | InChI=1S/C12H20N4O3S/c1-10(17)14-11-5-3-6-12(9-11)15-20(18,19)16(2)8-4-7-13/h3,5-6,9,15H,4,7-8,13H2,1-2H3,(H,14,17) |
| InChIKey | NJRSSPOQOSWOTH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |