C14H16OS — CID 61481652
2-(2,5-dimethylphenyl)-1-thiophen-2-ylethanol (PubChem CID 61481652) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1-thiophen-2-ylethanol.
| Compound Name | 2-(2,5-dimethylphenyl)-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 61481652 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1-thiophen-2-ylethanol |
| SMILES | Cc1ccc(C)c(CC(O)c2cccs2)c1 |
| InChI | InChI=1S/C14H16OS/c1-10-5-6-11(2)12(8-10)9-13(15)14-4-3-7-16-14/h3-8,13,15H,9H2,1-2H3 |
| InChIKey | KRVLFRUTTBSTQP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |