C17H21ClS — CID 63544769
2-[4-chloro-5-(2,5-dimethylphenyl)pentyl]thiophene (PubChem CID 63544769) has the molecular formula C17H21ClS and a molecular weight of 292.88 g/mol. Its IUPAC name is 2-[4-chloro-5-(2,5-dimethylphenyl)pentyl]thiophene.
| Compound Name | 2-[4-chloro-5-(2,5-dimethylphenyl)pentyl]thiophene |
|---|---|
| PubChem CID | 63544769 |
| Molecular Formula | C17H21ClS |
| Molecular Weight | 292.88 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[4-chloro-5-(2,5-dimethylphenyl)pentyl]thiophene |
| SMILES | Cc1ccc(C)c(CC(Cl)CCCc2cccs2)c1 |
| InChI | InChI=1S/C17H21ClS/c1-13-8-9-14(2)15(11-13)12-16(18)5-3-6-17-7-4-10-19-17/h4,7-11,16H,3,5-6,12H2,1-2H3 |
| InChIKey | BLABJLMFZNHIKH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|