C16H20N2O3 — CID 61487044
N-(3-methylbutyl)-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide (PubChem CID 61487044) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-(3-methylbutyl)-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 61487044 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(3-methylbutyl)-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide |
| SMILES | Cc1cccc2c1N(CC(=O)NCCC(C)C)C(=O)C2=O |
| InChI | InChI=1S/C16H20N2O3/c1-10(2)7-8-17-13(19)9-18-14-11(3)5-4-6-12(14)15(20)16(18)21/h4-6,10H,7-9H2,1-3H3,(H,17,19) |
| InChIKey | RQYGJYSSAHEKSI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|