C12H11N3O4 — CID 61146555
N-carbamoyl-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide (PubChem CID 61146555) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-carbamoyl-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide.
| Compound Name | N-carbamoyl-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 61146555 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-carbamoyl-2-(7-methyl-2,3-dioxoindol-1-yl)acetamide |
| SMILES | Cc1cccc2c1N(CC(=O)NC(N)=O)C(=O)C2=O |
| InChI | InChI=1S/C12H11N3O4/c1-6-3-2-4-7-9(6)15(11(18)10(7)17)5-8(16)14-12(13)19/h2-4H,5H2,1H3,(H3,13,14,16,19) |
| InChIKey | UVCFQIVMNWMFHD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|