About 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid
3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid (PubChem CID 61492654) has the molecular formula C11H10F3NO5S
and a molecular weight of 325.26 g/mol. Its IUPAC name is 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid.
Molecular Properties
| Compound Name | 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid |
| PubChem CID | 61492654 |
| Molecular Formula | C11H10F3NO5S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid |
| SMILES | O=C(CS(=O)(=O)c1cccc(C(=O)O)c1)NCC(F)(F)F |
| InChI | InChI=1S/C11H10F3NO5S/c12-11(13,14)6-15-9(16)5-21(19,20)8-3-1-2-7(4-8)10(17)18/h1-4H,5-6H2,(H,15,16)(H,17,18) |
| InChIKey | FNMRGHNCJPKDSG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid?
The IUPAC name of 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid (CID 61492654) is 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid.
What is the SMILES notation for 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid?
The canonical SMILES for 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid is O=C(CS(=O)(=O)c1cccc(C(=O)O)c1)NCC(F)(F)F.
What is the InChIKey of 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid?
The InChIKey is FNMRGHNCJPKDSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO5S/c12-11(13,14)6-15-9(16)5-21(19,20)8-3-1-2-7(4-8)10(17)18/h1-4H,5-6H2,(H,15,16)(H,17,18).
What are the key properties of 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid?
3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid has a molecular weight of 325.26 g/mol, XLogP of 0.84, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid is sourced from PubChem (CID 61492654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).