C11H10F3NO5S — CID 61492654
3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid (PubChem CID 61492654) has the molecular formula C11H10F3NO5S and a molecular weight of 325.26 g/mol. Its IUPAC name is 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid.
| Compound Name | 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 61492654 |
| Molecular Formula | C11H10F3NO5S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 3-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]sulfonylbenzoic acid |
| SMILES | O=C(CS(=O)(=O)c1cccc(C(=O)O)c1)NCC(F)(F)F |
| InChI | InChI=1S/C11H10F3NO5S/c12-11(13,14)6-15-9(16)5-21(19,20)8-3-1-2-7(4-8)10(17)18/h1-4H,5-6H2,(H,15,16)(H,17,18) |
| InChIKey | FNMRGHNCJPKDSG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |