C17H12BrN7 — CID 6164575
3-(4-bromophenyl)-N-[(Z)-pyridin-3-ylmethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 6164575) has the molecular formula C17H12BrN7 and a molecular weight of 394.24 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[(Z)-pyridin-3-ylmethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(4-bromophenyl)-N-[(Z)-pyridin-3-ylmethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 6164575 |
| Molecular Formula | C17H12BrN7 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 3-(4-bromophenyl)-N-[(Z)-pyridin-3-ylmethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Brc1ccc(-c2nnc3ccc(N/N=C\c4cccnc4)nn23)cc1 |
| InChI | InChI=1S/C17H12BrN7/c18-14-5-3-13(4-6-14)17-23-22-16-8-7-15(24-25(16)17)21-20-11-12-2-1-9-19-10-12/h1-11H,(H,21,24)/b20-11- |
| InChIKey | PREQWVFYIQTKRU-JAIQZWGSSA-N |
| XLogP | 3.39 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|