C13H17N3O3 — CID 62016972
3-methyl-5-(2,4,6-trimethoxyphenyl)imidazol-4-amine (PubChem CID 62016972) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-methyl-5-(2,4,6-trimethoxyphenyl)imidazol-4-amine.
| Compound Name | 3-methyl-5-(2,4,6-trimethoxyphenyl)imidazol-4-amine |
|---|---|
| PubChem CID | 62016972 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-methyl-5-(2,4,6-trimethoxyphenyl)imidazol-4-amine |
| SMILES | COc1cc(OC)c(-c2ncn(C)c2N)c(OC)c1 |
| InChI | InChI=1S/C13H17N3O3/c1-16-7-15-12(13(16)14)11-9(18-3)5-8(17-2)6-10(11)19-4/h5-7H,14H2,1-4H3 |
| InChIKey | PXKROAYMCJTZNE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |