C12H15FN6O — CID 62103248
2-amino-4-fluoro-5-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide (PubChem CID 62103248) has the molecular formula C12H15FN6O and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide.
| Compound Name | 2-amino-4-fluoro-5-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 62103248 |
| Molecular Formula | C12H15FN6O |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-amino-4-fluoro-5-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzamide |
| SMILES | CC(Nc1cc(C(N)=O)c(N)cc1F)c1nncn1C |
| InChI | InChI=1S/C12H15FN6O/c1-6(12-18-16-5-19(12)2)17-10-3-7(11(15)20)9(14)4-8(10)13/h3-6,17H,14H2,1-2H3,(H2,15,20) |
| InChIKey | PEKYHCFIRXJCGE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|