C11H16N6O2S — CID 62119547
3-amino-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenesulfonamide (PubChem CID 62119547) has the molecular formula C11H16N6O2S and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-amino-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenesulfonamide.
| Compound Name | 3-amino-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 62119547 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-amino-4-[1-(4-methyl-1,2,4-triazol-3-yl)ethylamino]benzenesulfonamide |
| SMILES | CC(Nc1ccc(S(N)(=O)=O)cc1N)c1nncn1C |
| InChI | InChI=1S/C11H16N6O2S/c1-7(11-16-14-6-17(11)2)15-10-4-3-8(5-9(10)12)20(13,18)19/h3-7,15H,12H2,1-2H3,(H2,13,18,19) |
| InChIKey | VLLSMCCXBGYVQC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|