C14H13F2N5O4 — CID 6210774
N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3-nitropyrazol-1-yl)propanamide (PubChem CID 6210774) has the molecular formula C14H13F2N5O4 and a molecular weight of 353.29 g/mol. Its IUPAC name is N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 6210774 |
| Molecular Formula | C14H13F2N5O4 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[(Z)-[4-(difluoromethoxy)phenyl]methylideneamino]-3-(3-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1ccc([N+](=O)[O-])n1)N/N=C\c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H13F2N5O4/c15-14(16)25-11-3-1-10(2-4-11)9-17-18-13(22)6-8-20-7-5-12(19-20)21(23)24/h1-5,7,9,14H,6,8H2,(H,18,22)/b17-9- |
| InChIKey | QUISOHFTIFSAAA-MFOYZWKCSA-N |
| XLogP | 1.93 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|