C19H16FNO5 — CID 6212345
[4-(4-fluorophenyl)-4-oxobutyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 6212345) has the molecular formula C19H16FNO5 and a molecular weight of 357.34 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-4-oxobutyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [4-(4-fluorophenyl)-4-oxobutyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6212345 |
| Molecular Formula | C19H16FNO5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [4-(4-fluorophenyl)-4-oxobutyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)OCCCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FNO5/c20-16-9-7-15(8-10-16)18(22)5-2-12-26-19(23)11-6-14-3-1-4-17(13-14)21(24)25/h1,3-4,6-11,13H,2,5,12H2/b11-6+ |
| InChIKey | QKEKBRCFOJHSBW-IZZDOVSWSA-N |
| XLogP | 3.95 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|