C19H19F2NO3S — CID 6212939
4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 6212939) has the molecular formula C19H19F2NO3S and a molecular weight of 379.43 g/mol. Its IUPAC name is 4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 6212939 |
| Molecular Formula | C19H19F2NO3S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-[(E)-3-(2,6-difluorophenyl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)/C=C/c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C19H19F2NO3S/c1-3-22(4-2)26(24,25)15-10-8-14(9-11-15)19(23)13-12-16-17(20)6-5-7-18(16)21/h5-13H,3-4H2,1-2H3/b13-12+ |
| InChIKey | IBNBJPHTCZKWHD-OUKQBFOZSA-N |
| XLogP | 3.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|