C20H23N3O3S2 — CID 52541406
4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 52541406) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 52541406 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-[(E)-3-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)/C=C/c2c(C)nc3sc(C)cn23)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-5-22(6-2)28(25,26)17-9-7-16(8-10-17)19(24)12-11-18-15(4)21-20-23(18)13-14(3)27-20/h7-13H,5-6H2,1-4H3/b12-11+ |
| InChIKey | ZXGGTNXUFSTHNL-VAWYXSNFSA-N |
| XLogP | 3.94 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|