C13H16N4OS2 — CID 62189993
N-[4-[[5-(ethylamino)thiadiazol-4-yl]methylsulfanyl]phenyl]acetamide (PubChem CID 62189993) has the molecular formula C13H16N4OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N-[4-[[5-(ethylamino)thiadiazol-4-yl]methylsulfanyl]phenyl]acetamide.
| Compound Name | N-[4-[[5-(ethylamino)thiadiazol-4-yl]methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 62189993 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[4-[[5-(ethylamino)thiadiazol-4-yl]methylsulfanyl]phenyl]acetamide |
| SMILES | CCNc1snnc1CSc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C13H16N4OS2/c1-3-14-13-12(16-17-20-13)8-19-11-6-4-10(5-7-11)15-9(2)18/h4-7,14H,3,8H2,1-2H3,(H,15,18) |
| InChIKey | UGEZJKQCRZXCBT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |