C12H11F3N2O — CID 62203397
2-methyl-8-(2,2,2-trifluoroethoxy)quinolin-4-amine (PubChem CID 62203397) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is 2-methyl-8-(2,2,2-trifluoroethoxy)quinolin-4-amine.
| Compound Name | 2-methyl-8-(2,2,2-trifluoroethoxy)quinolin-4-amine |
|---|---|
| PubChem CID | 62203397 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-methyl-8-(2,2,2-trifluoroethoxy)quinolin-4-amine |
| SMILES | Cc1cc(N)c2cccc(OCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C12H11F3N2O/c1-7-5-9(16)8-3-2-4-10(11(8)17-7)18-6-12(13,14)15/h2-5H,6H2,1H3,(H2,16,17) |
| InChIKey | FCWNSERZSCEJQU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |