C12H14N2O3S — CID 62206727
5-[(4-tert-butyl-1,3-thiazol-2-yl)amino]furan-2-carboxylic acid (PubChem CID 62206727) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-[(4-tert-butyl-1,3-thiazol-2-yl)amino]furan-2-carboxylic acid.
| Compound Name | 5-[(4-tert-butyl-1,3-thiazol-2-yl)amino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62206727 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-[(4-tert-butyl-1,3-thiazol-2-yl)amino]furan-2-carboxylic acid |
| SMILES | CC(C)(C)c1csc(Nc2ccc(C(=O)O)o2)n1 |
| InChI | InChI=1S/C12H14N2O3S/c1-12(2,3)8-6-18-11(13-8)14-9-5-4-7(17-9)10(15)16/h4-6H,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | UKWQBUXCWXTGLT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |