C15H12N2O2S2 — CID 62233377
3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 62233377) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62233377 |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2[nH]c(=S)n1CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H12N2O2S2/c18-14-13-11(5-6-21-13)16-15(20)17(14)8-10-7-9-3-1-2-4-12(9)19-10/h1-6,10H,7-8H2,(H,16,20) |
| InChIKey | RHWLIADPLUIOEJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|