C13H10ClN5OS — CID 62238142
N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide (PubChem CID 62238142) has the molecular formula C13H10ClN5OS and a molecular weight of 319.78 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62238142 |
| Molecular Formula | C13H10ClN5OS |
| Molecular Weight | 319.78 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-hydrazinylpyridine-2-carboxamide |
| SMILES | NNc1ccnc(C(=O)Nc2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C13H10ClN5OS/c14-7-1-2-9-11(5-7)21-13(17-9)18-12(20)10-6-8(19-15)3-4-16-10/h1-6H,15H2,(H,16,19)(H,17,18,20) |
| InChIKey | WSGJVJAUOILXTG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|