C13H23N5O2 — CID 62243675
6-hydrazinyl-N-(2-methoxyethyl)-N-pentan-3-ylpyridazine-3-carboxamide (PubChem CID 62243675) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-methoxyethyl)-N-pentan-3-ylpyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(2-methoxyethyl)-N-pentan-3-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62243675 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 6-hydrazinyl-N-(2-methoxyethyl)-N-pentan-3-ylpyridazine-3-carboxamide |
| SMILES | CCC(CC)N(CCOC)C(=O)c1ccc(NN)nn1 |
| InChI | InChI=1S/C13H23N5O2/c1-4-10(5-2)18(8-9-20-3)13(19)11-6-7-12(15-14)17-16-11/h6-7,10H,4-5,8-9,14H2,1-3H3,(H,15,17) |
| InChIKey | ZBBKHTYLBDSVSE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|