C13H16N4 — CID 62252767
[5,6-dimethyl-2-(3-methylphenyl)pyrimidin-4-yl]hydrazine (PubChem CID 62252767) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is [5,6-dimethyl-2-(3-methylphenyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [5,6-dimethyl-2-(3-methylphenyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62252767 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [5,6-dimethyl-2-(3-methylphenyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cccc(-c2nc(C)c(C)c(NN)n2)c1 |
| InChI | InChI=1S/C13H16N4/c1-8-5-4-6-11(7-8)13-15-10(3)9(2)12(16-13)17-14/h4-7H,14H2,1-3H3,(H,15,16,17) |
| InChIKey | VHLRWTCFTGSVRK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|