C14H14N2O3S — CID 62253112
3-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]prop-2-yn-1-ol (PubChem CID 62253112) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 62253112 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]prop-2-yn-1-ol |
| SMILES | Cc1nnc(SCCOc2ccc(C#CCO)cc2)o1 |
| InChI | InChI=1S/C14H14N2O3S/c1-11-15-16-14(19-11)20-10-9-18-13-6-4-12(5-7-13)3-2-8-17/h4-7,17H,8-10H2,1H3 |
| InChIKey | QPWSYKPAUKTWCG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|