C15H29F3N2 — CID 62257260
N-[[1-[[propyl(2,2,2-trifluoroethyl)amino]methyl]cyclopentyl]methyl]propan-1-amine (PubChem CID 62257260) has the molecular formula C15H29F3N2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[[1-[[propyl(2,2,2-trifluoroethyl)amino]methyl]cyclopentyl]methyl]propan-1-amine.
| Compound Name | N-[[1-[[propyl(2,2,2-trifluoroethyl)amino]methyl]cyclopentyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62257260 |
| Molecular Formula | C15H29F3N2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | N-[[1-[[propyl(2,2,2-trifluoroethyl)amino]methyl]cyclopentyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(CN(CCC)CC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C15H29F3N2/c1-3-9-19-11-14(7-5-6-8-14)12-20(10-4-2)13-15(16,17)18/h19H,3-13H2,1-2H3 |
| InChIKey | ZPYLNEBBLAGPFJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|