C12H19F9N2 — CID 89189108
N-[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 89189108) has the molecular formula C12H19F9N2 and a molecular weight of 362.28 g/mol. Its IUPAC name is N-[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 89189108 |
| Molecular Formula | C12H19F9N2 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[3,3,5,6,6,6-hexafluoro-5-(trifluoromethyl)hexyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCCC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H19F9N2/c1-23(2)7-3-5-22-6-4-9(13,14)8-10(15,11(16,17)18)12(19,20)21/h22H,3-8H2,1-2H3 |
| InChIKey | DKPGJFZHFYRLEX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|