C13H12N2OS2 — CID 62269824
3-[2-[(4-methylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 62269824) has the molecular formula C13H12N2OS2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 3-[2-[(4-methylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(4-methylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 62269824 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-[2-[(4-methylpyrimidin-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | Cc1ccnc(SCc2sccc2C#CCO)n1 |
| InChI | InChI=1S/C13H12N2OS2/c1-10-4-6-14-13(15-10)18-9-12-11(3-2-7-16)5-8-17-12/h4-6,8,16H,7,9H2,1H3 |
| InChIKey | WJLHSVINESDDKP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|