C25H18ClFN6O — CID 6229686
3-(2-chloro-6-fluorophenyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 6229686) has the molecular formula C25H18ClFN6O and a molecular weight of 472.91 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 6229686 |
| Molecular Formula | C25H18ClFN6O |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Fc1cccc(Cl)c1-c1nnc2ccc(N/N=C\c3cccc(OCc4ccccc4)c3)nn12 |
| InChI | InChI=1S/C25H18ClFN6O/c26-20-10-5-11-21(27)24(20)25-31-30-23-13-12-22(32-33(23)25)29-28-15-18-8-4-9-19(14-18)34-16-17-6-2-1-3-7-17/h1-15H,16H2,(H,29,32)/b28-15- |
| InChIKey | FNABTIKINMWFMG-MBTHVWNTSA-N |
| XLogP | 5.61 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|