C12H12F2O4S — CID 62300833
5-[(2,5-difluorophenyl)sulfinylmethyl]oxolane-2-carboxylic acid (PubChem CID 62300833) has the molecular formula C12H12F2O4S and a molecular weight of 290.29 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)sulfinylmethyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(2,5-difluorophenyl)sulfinylmethyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 62300833 |
| Molecular Formula | C12H12F2O4S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 5-[(2,5-difluorophenyl)sulfinylmethyl]oxolane-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(CS(=O)c2cc(F)ccc2F)O1 |
| InChI | InChI=1S/C12H12F2O4S/c13-7-1-3-9(14)11(5-7)19(17)6-8-2-4-10(18-8)12(15)16/h1,3,5,8,10H,2,4,6H2,(H,15,16) |
| InChIKey | PGPFYVFAUZYJGR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |