C9H14BrNO2 — CID 62335415
1-[(5-bromofuran-2-yl)methyl-methylamino]propan-2-ol (PubChem CID 62335415) has the molecular formula C9H14BrNO2 and a molecular weight of 248.12 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl-methylamino]propan-2-ol.
| Compound Name | 1-[(5-bromofuran-2-yl)methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 62335415 |
| Molecular Formula | C9H14BrNO2 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl-methylamino]propan-2-ol |
| SMILES | CC(O)CN(C)Cc1ccc(Br)o1 |
| InChI | InChI=1S/C9H14BrNO2/c1-7(12)5-11(2)6-8-3-4-9(10)13-8/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | UDWDDVZSXSHJFQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |