C15H20N2O3 — CID 62349908
1-(2,4-dimethoxyphenyl)-2-(4,5-dimethylimidazol-1-yl)ethanol (PubChem CID 62349908) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(4,5-dimethylimidazol-1-yl)ethanol.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(4,5-dimethylimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 62349908 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(4,5-dimethylimidazol-1-yl)ethanol |
| SMILES | COc1ccc(C(O)Cn2cnc(C)c2C)c(OC)c1 |
| InChI | InChI=1S/C15H20N2O3/c1-10-11(2)17(9-16-10)8-14(18)13-6-5-12(19-3)7-15(13)20-4/h5-7,9,14,18H,8H2,1-4H3 |
| InChIKey | PGTUHFAJZRNXMQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |