C16H19N3O — CID 62350590
3-[5-[(4,5-dimethylimidazol-1-yl)methyl]-2-methoxyphenyl]prop-2-yn-1-amine (PubChem CID 62350590) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-[5-[(4,5-dimethylimidazol-1-yl)methyl]-2-methoxyphenyl]prop-2-yn-1-amine.
| Compound Name | 3-[5-[(4,5-dimethylimidazol-1-yl)methyl]-2-methoxyphenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 62350590 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[5-[(4,5-dimethylimidazol-1-yl)methyl]-2-methoxyphenyl]prop-2-yn-1-amine |
| SMILES | COc1ccc(Cn2cnc(C)c2C)cc1C#CCN |
| InChI | InChI=1S/C16H19N3O/c1-12-13(2)19(11-18-12)10-14-6-7-16(20-3)15(9-14)5-4-8-17/h6-7,9,11H,8,10,17H2,1-3H3 |
| InChIKey | YFODGAHYHUTHMQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|