About 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine]
2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] (PubChem CID 62354992) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine].
Molecular Properties
| Compound Name | 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] |
| PubChem CID | 62354992 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] |
| SMILES | CCC1NCCC12CCOc1ccccc12 |
| InChI | InChI=1S/C14H19NO/c1-2-13-14(7-9-15-13)8-10-16-12-6-4-3-5-11(12)14/h3-6,13,15H,2,7-10H2,1H3 |
| InChIKey | ZFJOOLGASFQLDG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
The IUPAC name of 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] (CID 62354992) is 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine].
What is the SMILES notation for 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
The canonical SMILES for 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] is CCC1NCCC12CCOc1ccccc12.
What is the InChIKey of 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
The InChIKey is ZFJOOLGASFQLDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-2-13-14(7-9-15-13)8-10-16-12-6-4-3-5-11(12)14/h3-6,13,15H,2,7-10H2,1H3.
What are the key properties of 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] has a molecular weight of 217.31 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-ethylspiro[2,3-dihydrochromene-4,3'-pyrrolidine] is sourced from PubChem (CID 62354992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).