C18H17N3O5 — CID 6236216
[(E)-4-amino-3-cyano-2-oxopent-3-enyl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 6236216) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 6236216 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [(E)-4-amino-3-cyano-2-oxopent-3-enyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | C/C(N)=C(/C#N)C(=O)COC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H17N3O5/c1-11(20)14(9-19)15(22)10-26-16(23)7-4-8-21-17(24)12-5-2-3-6-13(12)18(21)25/h2-3,5-6H,4,7-8,10,20H2,1H3/b14-11+ |
| InChIKey | PDQLNCNFXKEEQB-SDNWHVSQSA-N |
| XLogP | 0.93 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|