C13H13N3O4 — CID 623782
5-hydroxy-5-(1-methyl-2,3-dihydroindol-5-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 623782) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 5-hydroxy-5-(1-methyl-2,3-dihydroindol-5-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-hydroxy-5-(1-methyl-2,3-dihydroindol-5-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 623782 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-hydroxy-5-(1-methyl-2,3-dihydroindol-5-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | CN1CCc2cc(C3(O)C(=O)NC(=O)NC3=O)ccc21 |
| InChI | InChI=1S/C13H13N3O4/c1-16-5-4-7-6-8(2-3-9(7)16)13(20)10(17)14-12(19)15-11(13)18/h2-3,6,20H,4-5H2,1H3,(H2,14,15,17,18,19) |
| InChIKey | IQGHSFQFIRLUMX-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|