C12H17Cl2N3 — CID 62378882
1-(2,6-dichloro-3-methylphenyl)-2-(2-methylpropyl)guanidine (PubChem CID 62378882) has the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. Its IUPAC name is 1-(2,6-dichloro-3-methylphenyl)-2-(2-methylpropyl)guanidine.
| Compound Name | 1-(2,6-dichloro-3-methylphenyl)-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 62378882 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-(2,6-dichloro-3-methylphenyl)-2-(2-methylpropyl)guanidine |
| SMILES | Cc1ccc(Cl)c(N/C(N)=N/CC(C)C)c1Cl |
| InChI | InChI=1S/C12H17Cl2N3/c1-7(2)6-16-12(15)17-11-9(13)5-4-8(3)10(11)14/h4-5,7H,6H2,1-3H3,(H3,15,16,17) |
| InChIKey | KWKBXBMYEQXSKJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|