C22H20N8O4 — CID 6243096
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(Z)-4-phenylbutan-2-ylideneamino]triazole-4-carboxamide (PubChem CID 6243096) has the molecular formula C22H20N8O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(Z)-4-phenylbutan-2-ylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(Z)-4-phenylbutan-2-ylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6243096 |
| Molecular Formula | C22H20N8O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-N-[(Z)-4-phenylbutan-2-ylideneamino]triazole-4-carboxamide |
| SMILES | C/C(CCc1ccccc1)=N/NC(=O)c1nnn(-c2nonc2N)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H20N8O4/c1-13(7-8-14-5-3-2-4-6-14)24-26-22(31)18-19(15-9-10-16-17(11-15)33-12-32-16)30(29-25-18)21-20(23)27-34-28-21/h2-6,9-11H,7-8,12H2,1H3,(H2,23,27)(H,26,31)/b24-13- |
| InChIKey | DGMDMFZXPMGXJR-CFRMEGHHSA-N |
| XLogP | 2.37 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|