C17H33NO2S — CID 62528446
N-[2-(1,1-dioxothiolan-3-yl)decyl]cyclopropanamine (PubChem CID 62528446) has the molecular formula C17H33NO2S and a molecular weight of 315.52 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)decyl]cyclopropanamine.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)decyl]cyclopropanamine |
|---|---|
| PubChem CID | 62528446 |
| Molecular Formula | C17H33NO2S |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)decyl]cyclopropanamine |
| SMILES | CCCCCCCCC(CNC1CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H33NO2S/c1-2-3-4-5-6-7-8-15(13-18-17-9-10-17)16-11-12-21(19,20)14-16/h15-18H,2-14H2,1H3 |
| InChIKey | ORGHPNBDFGVMMO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|