C10H15N3 — CID 62539150
N'-amino-2-(3,4-dimethylphenyl)ethanimidamide (PubChem CID 62539150) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N'-amino-2-(3,4-dimethylphenyl)ethanimidamide.
| Compound Name | N'-amino-2-(3,4-dimethylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 62539150 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N'-amino-2-(3,4-dimethylphenyl)ethanimidamide |
| SMILES | Cc1ccc(C/C(N)=N/N)cc1C |
| InChI | InChI=1S/C10H15N3/c1-7-3-4-9(5-8(7)2)6-10(11)13-12/h3-5H,6,12H2,1-2H3,(H2,11,13) |
| InChIKey | WGVHTNCUVIXPIR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|