C9H13BO2 — CID 63702768
(3,4-dimethylphenyl)methylboronic acid (PubChem CID 63702768) has the molecular formula C9H13BO2 and a molecular weight of 164.01 g/mol. Its IUPAC name is (3,4-dimethylphenyl)methylboronic acid.
| Compound Name | (3,4-dimethylphenyl)methylboronic acid |
|---|---|
| PubChem CID | 63702768 |
| Molecular Formula | C9H13BO2 |
| Molecular Weight | 164.01 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (3,4-dimethylphenyl)methylboronic acid |
| SMILES | Cc1ccc(CB(O)O)cc1C |
| InChI | InChI=1S/C9H13BO2/c1-7-3-4-9(5-8(7)2)6-10(11)12/h3-5,11-12H,6H2,1-2H3 |
| InChIKey | MNWBIZPWPCKSRW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.01 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|