(3,4-dimethylphenyl)methylboronic acid

C9H13BO2 — CID 63702768

IUPAC(3,4-dimethylphenyl)methylboronic acid
SMILESCc1ccc(CB(O)O)cc1C
InChIInChI=1S/C9H13BO2/c1-7-3-4-9(5-8(7)2)6-10(11)12/h3-5,11-12H,6H2,1-2H3
InChIKeyMNWBIZPWPCKSRW-UHFFFAOYSA-N
MW164.01 g/mol
LogP0.86
Rot. Bonds2

About (3,4-dimethylphenyl)methylboronic acid

(3,4-dimethylphenyl)methylboronic acid (PubChem CID 63702768) has the molecular formula C9H13BO2 and a molecular weight of 164.01 g/mol. Its IUPAC name is (3,4-dimethylphenyl)methylboronic acid.

Molecular Properties

Compound Name(3,4-dimethylphenyl)methylboronic acid
PubChem CID63702768
Molecular FormulaC9H13BO2
Molecular Weight164.01 g/mol
Exact Mass164.10
IUPAC Name(3,4-dimethylphenyl)methylboronic acid
SMILESCc1ccc(CB(O)O)cc1C
InChIInChI=1S/C9H13BO2/c1-7-3-4-9(5-8(7)2)6-10(11)12/h3-5,11-12H,6H2,1-2H3
InChIKeyMNWBIZPWPCKSRW-UHFFFAOYSA-N
XLogP0.86
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.01
LogP ≤ 50.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3,4-dimethylphenyl)methylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,4-dimethylphenyl)methylboronic acid?
The IUPAC name of (3,4-dimethylphenyl)methylboronic acid (CID 63702768) is (3,4-dimethylphenyl)methylboronic acid.
What is the SMILES notation for (3,4-dimethylphenyl)methylboronic acid?
The canonical SMILES for (3,4-dimethylphenyl)methylboronic acid is Cc1ccc(CB(O)O)cc1C.
What is the InChIKey of (3,4-dimethylphenyl)methylboronic acid?
The InChIKey is MNWBIZPWPCKSRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BO2/c1-7-3-4-9(5-8(7)2)6-10(11)12/h3-5,11-12H,6H2,1-2H3.
What are the key properties of (3,4-dimethylphenyl)methylboronic acid?
(3,4-dimethylphenyl)methylboronic acid has a molecular weight of 164.01 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl)methylboronic acid is sourced from PubChem (CID 63702768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).